About methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate
methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate (PubChem CID 129155283) has the molecular formula C25H22N6O3
and a molecular weight of 454.49 g/mol. Its IUPAC name is methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate.
Molecular Properties
| Compound Name | methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate |
| PubChem CID | 129155283 |
| Molecular Formula | C25H22N6O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ncc2[nH]c(=O)n(Cc3ccc(-c4nc(C)cn4C)cc3)c2n1 |
| InChI | InChI=1S/C25H22N6O3/c1-15-13-30(2)22(27-15)17-10-8-16(9-11-17)14-31-23-20(28-25(31)33)12-26-21(29-23)18-6-4-5-7-19(18)24(32)34-3/h4-13H,14H2,1-3H3,(H,28,33) |
| InChIKey | CTRCWNPFBLVWBY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate?
The IUPAC name of methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate (CID 129155283) is methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate.
What is the SMILES notation for methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate?
The canonical SMILES for methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate is COC(=O)c1ccccc1-c1ncc2[nH]c(=O)n(Cc3ccc(-c4nc(C)cn4C)cc3)c2n1.
What is the InChIKey of methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate?
The InChIKey is CTRCWNPFBLVWBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N6O3/c1-15-13-30(2)22(27-15)17-10-8-16(9-11-17)14-31-23-20(28-25(31)33)12-26-21(29-23)18-6-4-5-7-19(18)24(32)34-3/h4-13H,14H2,1-3H3,(H,28,33).
What are the key properties of methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate?
methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate has a molecular weight of 454.49 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[9-[[4-(1,4-dimethylimidazol-2-yl)phenyl]methyl]-8-oxo-7H-purin-2-yl]benzoate is sourced from PubChem (CID 129155283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).