About (2-formylcyclohexyl) acetate
(2-formylcyclohexyl) acetate (PubChem CID 12915545) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is (2-formylcyclohexyl) acetate.
Molecular Properties
| Compound Name | (2-formylcyclohexyl) acetate |
| PubChem CID | 12915545 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (2-formylcyclohexyl) acetate |
| SMILES | CC(=O)OC1CCCCC1C=O |
| InChI | InChI=1S/C9H14O3/c1-7(11)12-9-5-3-2-4-8(9)6-10/h6,8-9H,2-5H2,1H3 |
| InChIKey | PZIZFDADWKNTCY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2-formylcyclohexyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-formylcyclohexyl) acetate?
The IUPAC name of (2-formylcyclohexyl) acetate (CID 12915545) is (2-formylcyclohexyl) acetate.
What is the SMILES notation for (2-formylcyclohexyl) acetate?
The canonical SMILES for (2-formylcyclohexyl) acetate is CC(=O)OC1CCCCC1C=O.
What is the InChIKey of (2-formylcyclohexyl) acetate?
The InChIKey is PZIZFDADWKNTCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-7(11)12-9-5-3-2-4-8(9)6-10/h6,8-9H,2-5H2,1H3.
What are the key properties of (2-formylcyclohexyl) acetate?
(2-formylcyclohexyl) acetate has a molecular weight of 170.21 g/mol, XLogP of 1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-formylcyclohexyl) acetate is sourced from PubChem (CID 12915545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).