C27H40O8 — CID 129155604
(1R,2S,4S,10S,14S,15R,16R,17R,18S,20R)-10,15,17-trihydroxy-7,7,16,19,19-pentamethyl-18-(2-methylbutoxy)-3,6,8-trioxahexacyclo[13.5.0.02,4.04,9.010,14.018,20]icos-12-en-11-one (PubChem CID 129155604) has the molecular formula C27H40O8 and a molecular weight of 492.61 g/mol. Its IUPAC name is (1R,2S,4S,10S,14S,15R,16R,17R,18S,20R)-10,15,17-trihydroxy-7,7,16,19,19-pentamethyl-18-(2-methylbutoxy)-3,6,8-trioxahexacyclo[13.5.0.02,4.04,9.010,14.018,20]icos-12-en-11-one.
| Compound Name | (1R,2S,4S,10S,14S,15R,16R,17R,18S,20R)-10,15,17-trihydroxy-7,7,16,19,19-pentamethyl-18-(2-methylbutoxy)-3,6,8-trioxahexacyclo[13.5.0.02,4.04,9.010,14.018,20]icos-12-en-11-one |
|---|---|
| PubChem CID | 129155604 |
| Molecular Formula | C27H40O8 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (1R,2S,4S,10S,14S,15R,16R,17R,18S,20R)-10,15,17-trihydroxy-7,7,16,19,19-pentamethyl-18-(2-methylbutoxy)-3,6,8-trioxahexacyclo[13.5.0.02,4.04,9.010,14.018,20]icos-12-en-11-one |
| SMILES | CCC(C)CO[C@@]12[C@H](O)[C@@H](C)[C@@]3(O)[C@H]([C@@H]1C2(C)C)[C@@H]1O[C@@]12COC(C)(C)OC2[C@]1(O)C(=O)C=C[C@@H]31 |
| InChI | InChI=1S/C27H40O8/c1-8-13(2)11-32-27-18(22(27,4)5)17-20-24(34-20)12-33-23(6,7)35-21(24)26(31)15(9-10-16(26)28)25(17,30)14(3)19(27)29/h9-10,13-15,17-21,29-31H,8,11-12H2,1-7H3/t13?,14-,15+,17-,18-,19-,20+,21?,24+,25+,26-,27-/m1/s1 |
| InChIKey | CPAVCKWBBAAJNX-YQQTUNPFSA-N |
| XLogP | 1.59 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|