C27H26BrNO6 — CID 129155806
(2S,3R,4R,5S,6R)-6-(4-bromophenyl)-10-butoxy-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxylic acid (PubChem CID 129155806) has the molecular formula C27H26BrNO6 and a molecular weight of 540.41 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-10-butoxy-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxylic acid.
| Compound Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-10-butoxy-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 129155806 |
| Molecular Formula | C27H26BrNO6 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-10-butoxy-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxylic acid |
| SMILES | CCCCOc1cnc2c(c1)O[C@@]1(c3ccc(Br)cc3)[C@H](c3ccccc3)[C@@H](C(=O)O)[C@@H](O)[C@@]21O |
| InChI | InChI=1S/C27H26BrNO6/c1-2-3-13-34-19-14-20-23(29-15-19)26(33)24(30)21(25(31)32)22(16-7-5-4-6-8-16)27(26,35-20)17-9-11-18(28)12-10-17/h4-12,14-15,21-22,24,30,33H,2-3,13H2,1H3,(H,31,32)/t21-,22-,24-,26+,27+/m1/s1 |
| InChIKey | PCQKMLPZGUKCEI-PXIJUOARSA-N |
| XLogP | 4.36 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|