C25H22F2N2O5 — CID 129156073
(2S,3R,4R,5S,6R)-6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 129156073) has the molecular formula C25H22F2N2O5 and a molecular weight of 468.46 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | (2S,3R,4R,5S,6R)-6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 129156073 |
| Molecular Formula | C25H22F2N2O5 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | COc1cncc2c1[C@]1(O)[C@H](O)[C@H](C(N)=O)[C@@H](c3ccccc3)[C@]1(c1ccc(C(F)F)cc1)O2 |
| InChI | InChI=1S/C25H22F2N2O5/c1-33-16-11-29-12-17-20(16)24(32)21(30)18(23(28)31)19(13-5-3-2-4-6-13)25(24,34-17)15-9-7-14(8-10-15)22(26)27/h2-12,18-19,21-22,30,32H,1H3,(H2,28,31)/t18-,19-,21-,24+,25+/m1/s1 |
| InChIKey | CWOLMKBBSGJQKJ-FGDBOXLNSA-N |
| XLogP | 2.76 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |