C8H3F14N — CID 129156369
2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,2,2-tetrafluoropropyl)piperidine (PubChem CID 129156369) has the molecular formula C8H3F14N and a molecular weight of 379.09 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,2,2-tetrafluoropropyl)piperidine.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,2,2-tetrafluoropropyl)piperidine |
|---|---|
| PubChem CID | 129156369 |
| Molecular Formula | C8H3F14N |
| Molecular Weight | 379.09 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,2,2-tetrafluoropropyl)piperidine |
| SMILES | CC(F)(F)C(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H3F14N/c1-2(9,10)6(17,18)23-7(19,20)4(13,14)3(11,12)5(15,16)8(23,21)22/h1H3 |
| InChIKey | VBKMQXIJZNJYDM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.09 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|