About (3S)-3-ethyl-1,4-dioxaspiro[4.5]decane
(3S)-3-ethyl-1,4-dioxaspiro[4.5]decane (PubChem CID 129156956) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (3S)-3-ethyl-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | (3S)-3-ethyl-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 129156956 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3S)-3-ethyl-1,4-dioxaspiro[4.5]decane |
| SMILES | CC[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C10H18O2/c1-2-9-8-11-10(12-9)6-4-3-5-7-10/h9H,2-8H2,1H3/t9-/m0/s1 |
| InChIKey | HIHAXTKRBWMBPJ-VIFPVBQESA-N |
| XLogP | 2.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-ethyl-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-ethyl-1,4-dioxaspiro[4.5]decane?
The IUPAC name of (3S)-3-ethyl-1,4-dioxaspiro[4.5]decane (CID 129156956) is (3S)-3-ethyl-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for (3S)-3-ethyl-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for (3S)-3-ethyl-1,4-dioxaspiro[4.5]decane is CC[C@H]1COC2(CCCCC2)O1.
What is the InChIKey of (3S)-3-ethyl-1,4-dioxaspiro[4.5]decane?
The InChIKey is HIHAXTKRBWMBPJ-VIFPVBQESA-N. The full InChI is InChI=1S/C10H18O2/c1-2-9-8-11-10(12-9)6-4-3-5-7-10/h9H,2-8H2,1H3/t9-/m0/s1.
What are the key properties of (3S)-3-ethyl-1,4-dioxaspiro[4.5]decane?
(3S)-3-ethyl-1,4-dioxaspiro[4.5]decane has a molecular weight of 170.25 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-ethyl-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 129156956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).