C9H19N — CID 129157038
N,3-dimethyl-N-[(Z)-prop-1-enyl]butan-2-amine (PubChem CID 129157038) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is N,3-dimethyl-N-[(Z)-prop-1-enyl]butan-2-amine.
| Compound Name | N,3-dimethyl-N-[(Z)-prop-1-enyl]butan-2-amine |
|---|---|
| PubChem CID | 129157038 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | N,3-dimethyl-N-[(Z)-prop-1-enyl]butan-2-amine |
| SMILES | C/C=C\N(C)C(C)C(C)C |
| InChI | InChI=1S/C9H19N/c1-6-7-10(5)9(4)8(2)3/h6-9H,1-5H3/b7-6- |
| InChIKey | LLTILHOSSQUCPN-SREVYHEPSA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |