C15H32I2N2 — CID 129157129
3,3-bis(iodomethyl)-N,N'-dimethyl-N,N'-di(propan-2-yl)pentane-1,5-diamine (PubChem CID 129157129) has the molecular formula C15H32I2N2 and a molecular weight of 494.24 g/mol. Its IUPAC name is 3,3-bis(iodomethyl)-N,N'-dimethyl-N,N'-di(propan-2-yl)pentane-1,5-diamine.
| Compound Name | 3,3-bis(iodomethyl)-N,N'-dimethyl-N,N'-di(propan-2-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 129157129 |
| Molecular Formula | C15H32I2N2 |
| Molecular Weight | 494.24 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 3,3-bis(iodomethyl)-N,N'-dimethyl-N,N'-di(propan-2-yl)pentane-1,5-diamine |
| SMILES | CC(C)N(C)CCC(CI)(CI)CCN(C)C(C)C |
| InChI | InChI=1S/C15H32I2N2/c1-13(2)18(5)9-7-15(11-16,12-17)8-10-19(6)14(3)4/h13-14H,7-12H2,1-6H3 |
| InChIKey | ZCBPQPQGLIYKJQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.24 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|