About (E)-2-amino-N'-methanimidoylbut-2-enimidamide
(E)-2-amino-N'-methanimidoylbut-2-enimidamide (PubChem CID 129157149) has the molecular formula C5H10N4
and a molecular weight of 126.16 g/mol. Its IUPAC name is (E)-2-amino-N'-methanimidoylbut-2-enimidamide.
Molecular Properties
| Compound Name | (E)-2-amino-N'-methanimidoylbut-2-enimidamide |
| PubChem CID | 129157149 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | (E)-2-amino-N'-methanimidoylbut-2-enimidamide |
| SMILES | [H]/N=C/N=C(N)/C(N)=C\C |
| InChI | InChI=1S/C5H10N4/c1-2-4(7)5(8)9-3-6/h2-3H,7H2,1H3,(H3,6,8,9)/b4-2+ |
| InChIKey | OVLBMVQLQCRDAW-DUXPYHPUSA-N |
| XLogP | -0.19 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-amino-N'-methanimidoylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-amino-N'-methanimidoylbut-2-enimidamide?
The IUPAC name of (E)-2-amino-N'-methanimidoylbut-2-enimidamide (CID 129157149) is (E)-2-amino-N'-methanimidoylbut-2-enimidamide.
What is the SMILES notation for (E)-2-amino-N'-methanimidoylbut-2-enimidamide?
The canonical SMILES for (E)-2-amino-N'-methanimidoylbut-2-enimidamide is [H]/N=C/N=C(N)/C(N)=C\C.
What is the InChIKey of (E)-2-amino-N'-methanimidoylbut-2-enimidamide?
The InChIKey is OVLBMVQLQCRDAW-DUXPYHPUSA-N. The full InChI is InChI=1S/C5H10N4/c1-2-4(7)5(8)9-3-6/h2-3H,7H2,1H3,(H3,6,8,9)/b4-2+.
What are the key properties of (E)-2-amino-N'-methanimidoylbut-2-enimidamide?
(E)-2-amino-N'-methanimidoylbut-2-enimidamide has a molecular weight of 126.16 g/mol, XLogP of -0.19, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-amino-N'-methanimidoylbut-2-enimidamide is sourced from PubChem (CID 129157149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).