C26H39NO — CID 129157184
(5Z,8Z,11Z,14Z,17Z)-1-(6-methyl-3,4-dihydro-2H-pyridin-1-yl)icosa-5,8,11,14,17-pentaen-1-one (PubChem CID 129157184) has the molecular formula C26H39NO and a molecular weight of 381.60 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-1-(6-methyl-3,4-dihydro-2H-pyridin-1-yl)icosa-5,8,11,14,17-pentaen-1-one.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-1-(6-methyl-3,4-dihydro-2H-pyridin-1-yl)icosa-5,8,11,14,17-pentaen-1-one |
|---|---|
| PubChem CID | 129157184 |
| Molecular Formula | C26H39NO |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-1-(6-methyl-3,4-dihydro-2H-pyridin-1-yl)icosa-5,8,11,14,17-pentaen-1-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N1CCCC=C1C |
| InChI | InChI=1S/C26H39NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-26(28)27-24-21-20-22-25(27)2/h4-5,7-8,10-11,13-14,16-17,22H,3,6,9,12,15,18-21,23-24H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | SAKVNEDKHDUVDG-JEBPEJKESA-N |
| XLogP | 7.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|