C21H20ClNO5S2 — CID 12915727
(4R)-3-[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]-2-(5-chloro-2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 12915727) has the molecular formula C21H20ClNO5S2 and a molecular weight of 465.98 g/mol. Its IUPAC name is (4R)-3-[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]-2-(5-chloro-2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]-2-(5-chloro-2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 12915727 |
| Molecular Formula | C21H20ClNO5S2 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | (4R)-3-[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]-2-(5-chloro-2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | C[C@H](CSC(=O)c1ccccc1)C(=O)N1C(c2cc(Cl)ccc2O)SC[C@H]1C(=O)O |
| InChI | InChI=1S/C21H20ClNO5S2/c1-12(10-30-21(28)13-5-3-2-4-6-13)18(25)23-16(20(26)27)11-29-19(23)15-9-14(22)7-8-17(15)24/h2-9,12,16,19,24H,10-11H2,1H3,(H,26,27)/t12-,16+,19?/m1/s1 |
| InChIKey | HQJWDTWLTVIHGS-HNENUHGKSA-N |
| XLogP | 4.28 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|