C23H20F4N6O3 — CID 129157492
N-[1-[8-fluoro-6-(3-methyl-1,2-oxazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethyl]-N-[(Z)-2-[3-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethenyl]formamide (PubChem CID 129157492) has the molecular formula C23H20F4N6O3 and a molecular weight of 504.44 g/mol. Its IUPAC name is N-[1-[8-fluoro-6-(3-methyl-1,2-oxazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethyl]-N-[(Z)-2-[3-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethenyl]formamide.
| Compound Name | N-[1-[8-fluoro-6-(3-methyl-1,2-oxazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethyl]-N-[(Z)-2-[3-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethenyl]formamide |
|---|---|
| PubChem CID | 129157492 |
| Molecular Formula | C23H20F4N6O3 |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | N-[1-[8-fluoro-6-(3-methyl-1,2-oxazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethyl]-N-[(Z)-2-[3-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethenyl]formamide |
| SMILES | Cc1cc(-c2cc(F)c3nnc(C(C)N(C=O)/C=C\c4ncc(OCC(F)(F)F)cc4C)n3c2)on1 |
| InChI | InChI=1S/C23H20F4N6O3/c1-13-6-17(35-11-23(25,26)27)9-28-19(13)4-5-32(12-34)15(3)21-29-30-22-18(24)8-16(10-33(21)22)20-7-14(2)31-36-20/h4-10,12,15H,11H2,1-3H3/b5-4- |
| InChIKey | UCDHOKNUXLRSKK-PLNGDYQASA-N |
| XLogP | 4.67 |
| TPSA | 98.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|