C24H28ClN7O5 — CID 129157644
N-[2-[2-[7-chloro-4-[[2-[[(1R)-2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-3-oxo-1H-isoindol-2-yl]ethyl]hydrazinyl]nitrous amide (PubChem CID 129157644) has the molecular formula C24H28ClN7O5 and a molecular weight of 529.99 g/mol. Its IUPAC name is N-[2-[2-[7-chloro-4-[[2-[[(1R)-2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-3-oxo-1H-isoindol-2-yl]ethyl]hydrazinyl]nitrous amide.
| Compound Name | N-[2-[2-[7-chloro-4-[[2-[[(1R)-2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-3-oxo-1H-isoindol-2-yl]ethyl]hydrazinyl]nitrous amide |
|---|---|
| PubChem CID | 129157644 |
| Molecular Formula | C24H28ClN7O5 |
| Molecular Weight | 529.99 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | N-[2-[2-[7-chloro-4-[[2-[[(1R)-2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-3-oxo-1H-isoindol-2-yl]ethyl]hydrazinyl]nitrous amide |
| SMILES | Cc1ccc([C@H](Nc2c(Nc3ccc(Cl)c4c3C(=O)N(CCNNNN=O)C4)c(=O)c2=O)C(C)(C)C)o1 |
| InChI | InChI=1S/C24H28ClN7O5/c1-12-5-8-16(37-12)22(24(2,3)4)28-19-18(20(33)21(19)34)27-15-7-6-14(25)13-11-32(23(35)17(13)15)10-9-26-29-30-31-36/h5-8,22,27-28H,9-11H2,1-4H3,(H,29,31)(H2,26,30,36)/t22-/m0/s1 |
| InChIKey | JLDFNYZSWWGMRS-QFIPXVFZSA-N |
| XLogP | 3.02 |
| TPSA | 157.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.99 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|