C23H23N5OS — CID 129157862
6-(2-methanethioyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)-N-(3-propan-2-ylphenyl)pyridine-2-carboxamide (PubChem CID 129157862) has the molecular formula C23H23N5OS and a molecular weight of 417.54 g/mol. Its IUPAC name is 6-(2-methanethioyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)-N-(3-propan-2-ylphenyl)pyridine-2-carboxamide.
| Compound Name | 6-(2-methanethioyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)-N-(3-propan-2-ylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 129157862 |
| Molecular Formula | C23H23N5OS |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 6-(2-methanethioyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)-N-(3-propan-2-ylphenyl)pyridine-2-carboxamide |
| SMILES | CC(C)c1cccc(NC(=O)c2cccc(N3CCc4nc(C=S)ncc4C3)n2)c1 |
| InChI | InChI=1S/C23H23N5OS/c1-15(2)16-5-3-6-18(11-16)25-23(29)20-7-4-8-22(27-20)28-10-9-19-17(13-28)12-24-21(14-30)26-19/h3-8,11-12,14-15H,9-10,13H2,1-2H3,(H,25,29) |
| InChIKey | MLZOGNOMPGPCCM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|