C19H36O3 — CID 129158243
7-(3-methoxy-3-methylbutoxy)-3,6,6,7-tetramethyl-5-methylideneoctan-4-one (PubChem CID 129158243) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is 7-(3-methoxy-3-methylbutoxy)-3,6,6,7-tetramethyl-5-methylideneoctan-4-one.
| Compound Name | 7-(3-methoxy-3-methylbutoxy)-3,6,6,7-tetramethyl-5-methylideneoctan-4-one |
|---|---|
| PubChem CID | 129158243 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | 7-(3-methoxy-3-methylbutoxy)-3,6,6,7-tetramethyl-5-methylideneoctan-4-one |
| SMILES | C=C(C(=O)C(C)CC)C(C)(C)C(C)(C)OCCC(C)(C)OC |
| InChI | InChI=1S/C19H36O3/c1-11-14(2)16(20)15(3)18(6,7)19(8,9)22-13-12-17(4,5)21-10/h14H,3,11-13H2,1-2,4-10H3 |
| InChIKey | DPIWBWRMKBSTGD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|