About [2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate
[2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate (PubChem CID 129158393) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is [2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate.
Molecular Properties
| Compound Name | [2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate |
| PubChem CID | 129158393 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | [2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate |
| SMILES | CC1(C)CCCC(C)(CN=C=O)C1OC#N |
| InChI | InChI=1S/C12H18N2O2/c1-11(2)5-4-6-12(3,7-14-9-15)10(11)16-8-13/h10H,4-7H2,1-3H3 |
| InChIKey | LZBIAHJDWGQAJY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze [2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate?
The IUPAC name of [2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate (CID 129158393) is [2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate.
What is the SMILES notation for [2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate?
The canonical SMILES for [2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate is CC1(C)CCCC(C)(CN=C=O)C1OC#N.
What is the InChIKey of [2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate?
The InChIKey is LZBIAHJDWGQAJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-11(2)5-4-6-12(3,7-14-9-15)10(11)16-8-13/h10H,4-7H2,1-3H3.
What are the key properties of [2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate?
[2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate has a molecular weight of 222.29 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(isocyanatomethyl)-2,6,6-trimethylcyclohexyl] cyanate is sourced from PubChem (CID 129158393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).