C9H12N2S — CID 129158397
2-(1,2,3,4-tetrahydropyridin-5-yl)-4H-1,4-thiazine (PubChem CID 129158397) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydropyridin-5-yl)-4H-1,4-thiazine.
| Compound Name | 2-(1,2,3,4-tetrahydropyridin-5-yl)-4H-1,4-thiazine |
|---|---|
| PubChem CID | 129158397 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 2-(1,2,3,4-tetrahydropyridin-5-yl)-4H-1,4-thiazine |
| SMILES | C1=CSC(C2=CNCCC2)=CN1 |
| InChI | InChI=1S/C9H12N2S/c1-2-8(6-10-3-1)9-7-11-4-5-12-9/h4-7,10-11H,1-3H2 |
| InChIKey | UJOWPYMBTATWNE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |