About 2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine
2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine (PubChem CID 129158742) has the molecular formula C22H30FNOS
and a molecular weight of 375.55 g/mol. Its IUPAC name is 2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine.
Molecular Properties
| Compound Name | 2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine |
| PubChem CID | 129158742 |
| Molecular Formula | C22H30FNOS |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine |
| SMILES | CCC1(CC)CC(CCNCc2cccs2)(c2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C22H30FNOS/c1-3-22(4-2)17-21(12-14-25-22,18-7-9-19(23)10-8-18)11-13-24-16-20-6-5-15-26-20/h5-10,15,24H,3-4,11-14,16-17H2,1-2H3 |
| InChIKey | XPORFFHHQPRPHR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine?
The IUPAC name of 2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine (CID 129158742) is 2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine.
What is the SMILES notation for 2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine?
The canonical SMILES for 2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine is CCC1(CC)CC(CCNCc2cccs2)(c2ccc(F)cc2)CCO1.
What is the InChIKey of 2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine?
The InChIKey is XPORFFHHQPRPHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30FNOS/c1-3-22(4-2)17-21(12-14-25-22,18-7-9-19(23)10-8-18)11-13-24-16-20-6-5-15-26-20/h5-10,15,24H,3-4,11-14,16-17H2,1-2H3.
What are the key properties of 2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine?
2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine has a molecular weight of 375.55 g/mol, XLogP of 5.67, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]-N-(thiophen-2-ylmethyl)ethanamine is sourced from PubChem (CID 129158742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).