C31H46O6 — CID 129158759
[(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] 1-methylcyclohexane-1-carboxylate (PubChem CID 129158759) has the molecular formula C31H46O6 and a molecular weight of 514.70 g/mol. Its IUPAC name is [(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] 1-methylcyclohexane-1-carboxylate.
| Compound Name | [(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] 1-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 129158759 |
| Molecular Formula | C31H46O6 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | [(4S,5S,6R,13S,15S)-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-18-oxo-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-4-yl] 1-methylcyclohexane-1-carboxylate |
| SMILES | CC1=CC23C(=O)[C@@H](C=C4COC(C)(C)O[C@H]4[C@]2(O)[C@H]1OC(=O)C1(C)CCCCC1)C(C)(C)[C@@H](C)CC3C |
| InChI | InChI=1S/C31H46O6/c1-18-16-30-20(3)14-19(2)27(4,5)22(23(30)32)15-21-17-35-28(6,7)37-25(21)31(30,34)24(18)36-26(33)29(8)12-10-9-11-13-29/h15-16,19-20,22,24-25,34H,9-14,17H2,1-8H3/t19-,20?,22+,24-,25+,30?,31+/m0/s1 |
| InChIKey | AQDGCBVZZBTNLW-DRNBTLDRSA-N |
| XLogP | 5.52 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|