C39H36ClN5O4 — CID 129159177
(2S)-N-[4-[2-[4-[[(2S)-1-(3-chloroisoquinoline-1-carbonyl)pyrrolidine-2-carbonyl]amino]phenyl]ethynyl]phenyl]-1-(2-cyclopropylacetyl)pyrrolidine-2-carboxamide (PubChem CID 129159177) has the molecular formula C39H36ClN5O4 and a molecular weight of 674.20 g/mol. Its IUPAC name is (2S)-N-[4-[2-[4-[[(2S)-1-(3-chloroisoquinoline-1-carbonyl)pyrrolidine-2-carbonyl]amino]phenyl]ethynyl]phenyl]-1-(2-cyclopropylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[2-[4-[[(2S)-1-(3-chloroisoquinoline-1-carbonyl)pyrrolidine-2-carbonyl]amino]phenyl]ethynyl]phenyl]-1-(2-cyclopropylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129159177 |
| Molecular Formula | C39H36ClN5O4 |
| Molecular Weight | 674.20 g/mol |
| Exact Mass | 673.25 |
| IUPAC Name | (2S)-N-[4-[2-[4-[[(2S)-1-(3-chloroisoquinoline-1-carbonyl)pyrrolidine-2-carbonyl]amino]phenyl]ethynyl]phenyl]-1-(2-cyclopropylacetyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(C#Cc2ccc(NC(=O)[C@@H]3CCCN3C(=O)c3nc(Cl)cc4ccccc34)cc2)cc1)[C@@H]1CCCN1C(=O)CC1CC1 |
| InChI | InChI=1S/C39H36ClN5O4/c40-34-24-28-5-1-2-6-31(28)36(43-34)39(49)45-22-4-8-33(45)38(48)42-30-19-15-26(16-20-30)10-9-25-13-17-29(18-14-25)41-37(47)32-7-3-21-44(32)35(46)23-27-11-12-27/h1-2,5-6,13-20,24,27,32-33H,3-4,7-8,11-12,21-23H2,(H,41,47)(H,42,48)/t32-,33-/m0/s1 |
| InChIKey | RGNMRLBFQVFEFS-LQJZCPKCSA-N |
| XLogP | 6.26 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.20 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|