C13H17NO2 — CID 129159414
1-ethyl-5-methyl-3-oxo-4,5,6,8a-tetrahydro-1H-cyclohepta[c]furan-3a-carbonitrile (PubChem CID 129159414) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-ethyl-5-methyl-3-oxo-4,5,6,8a-tetrahydro-1H-cyclohepta[c]furan-3a-carbonitrile.
| Compound Name | 1-ethyl-5-methyl-3-oxo-4,5,6,8a-tetrahydro-1H-cyclohepta[c]furan-3a-carbonitrile |
|---|---|
| PubChem CID | 129159414 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-ethyl-5-methyl-3-oxo-4,5,6,8a-tetrahydro-1H-cyclohepta[c]furan-3a-carbonitrile |
| SMILES | CCC1OC(=O)C2(C#N)CC(C)CC=CC12 |
| InChI | InChI=1S/C13H17NO2/c1-3-11-10-6-4-5-9(2)7-13(10,8-14)12(15)16-11/h4,6,9-11H,3,5,7H2,1-2H3 |
| InChIKey | BTBBZFOSEWQLHB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|