About 1-aminoethanethiol;hydrochloride
1-aminoethanethiol;hydrochloride (PubChem CID 12915949) has the molecular formula C2H8ClNS
and a molecular weight of 113.61 g/mol. Its IUPAC name is 1-aminoethanethiol;hydrochloride.
Molecular Properties
| Compound Name | 1-aminoethanethiol;hydrochloride |
| PubChem CID | 12915949 |
| Molecular Formula | C2H8ClNS |
| Molecular Weight | 113.61 g/mol |
| Exact Mass | 113.01 |
| IUPAC Name | 1-aminoethanethiol;hydrochloride |
| SMILES | CC(N)S.Cl |
| InChI | InChI=1S/C2H7NS.ClH/c1-2(3)4;/h2,4H,3H2,1H3;1H |
| InChIKey | GNETVHIDZPYGGD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.61 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethanethiol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethanethiol;hydrochloride?
The IUPAC name of 1-aminoethanethiol;hydrochloride (CID 12915949) is 1-aminoethanethiol;hydrochloride.
What is the SMILES notation for 1-aminoethanethiol;hydrochloride?
The canonical SMILES for 1-aminoethanethiol;hydrochloride is CC(N)S.Cl.
What is the InChIKey of 1-aminoethanethiol;hydrochloride?
The InChIKey is GNETVHIDZPYGGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NS.ClH/c1-2(3)4;/h2,4H,3H2,1H3;1H.
What are the key properties of 1-aminoethanethiol;hydrochloride?
1-aminoethanethiol;hydrochloride has a molecular weight of 113.61 g/mol, XLogP of 0.64, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethanethiol;hydrochloride is sourced from PubChem (CID 12915949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).