C30H28N2O2 — CID 129159713
1-(5,6-dihydro-1H-indol-3-yl)-2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]ethane-1,2-dione (PubChem CID 129159713) has the molecular formula C30H28N2O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-(5,6-dihydro-1H-indol-3-yl)-2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(5,6-dihydro-1H-indol-3-yl)-2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 129159713 |
| Molecular Formula | C30H28N2O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 1-(5,6-dihydro-1H-indol-3-yl)-2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCC(=C2c3ccccc3CCc3ccccc32)CC1)c1c[nH]c2c1=CCCC=2 |
| InChI | InChI=1S/C30H28N2O2/c33-29(26-19-31-27-12-6-5-11-25(26)27)30(34)32-17-15-22(16-18-32)28-23-9-3-1-7-20(23)13-14-21-8-2-4-10-24(21)28/h1-4,7-12,19,31H,5-6,13-18H2 |
| InChIKey | XBETWUXGILBDNL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|