C22H20FN3O4 — CID 129159814
(3R)-3-[2-[3-[5-fluoro-3-[hydroxy(methoxy)methyl]indazol-1-yl]phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 129159814) has the molecular formula C22H20FN3O4 and a molecular weight of 409.42 g/mol. Its IUPAC name is (3R)-3-[2-[3-[5-fluoro-3-[hydroxy(methoxy)methyl]indazol-1-yl]phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | (3R)-3-[2-[3-[5-fluoro-3-[hydroxy(methoxy)methyl]indazol-1-yl]phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 129159814 |
| Molecular Formula | C22H20FN3O4 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | (3R)-3-[2-[3-[5-fluoro-3-[hydroxy(methoxy)methyl]indazol-1-yl]phenyl]ethynyl]-3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | COC(O)c1nn(-c2cccc(C#C[C@]3(O)CCN(C)C3=O)c2)c2ccc(F)cc12 |
| InChI | InChI=1S/C22H20FN3O4/c1-25-11-10-22(29,21(25)28)9-8-14-4-3-5-16(12-14)26-18-7-6-15(23)13-17(18)19(24-26)20(27)30-2/h3-7,12-13,20,27,29H,10-11H2,1-2H3/t20?,22-/m0/s1 |
| InChIKey | IAJYYBNFSSIWGS-IAXKEJLGSA-N |
| XLogP | 1.75 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|