C13H21FO4 — CID 129160832
(2R,3Z)-3-[(E)-2-fluoroprop-1-enyl]-4-methoxy-2-(2-methoxyethoxy)hexa-3,5-dien-1-ol (PubChem CID 129160832) has the molecular formula C13H21FO4 and a molecular weight of 260.31 g/mol. Its IUPAC name is (2R,3Z)-3-[(E)-2-fluoroprop-1-enyl]-4-methoxy-2-(2-methoxyethoxy)hexa-3,5-dien-1-ol.
| Compound Name | (2R,3Z)-3-[(E)-2-fluoroprop-1-enyl]-4-methoxy-2-(2-methoxyethoxy)hexa-3,5-dien-1-ol |
|---|---|
| PubChem CID | 129160832 |
| Molecular Formula | C13H21FO4 |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2R,3Z)-3-[(E)-2-fluoroprop-1-enyl]-4-methoxy-2-(2-methoxyethoxy)hexa-3,5-dien-1-ol |
| SMILES | C=C/C(OC)=C(\C=C(/C)F)[C@H](CO)OCCOC |
| InChI | InChI=1S/C13H21FO4/c1-5-12(17-4)11(8-10(2)14)13(9-15)18-7-6-16-3/h5,8,13,15H,1,6-7,9H2,2-4H3/b10-8+,12-11-/t13-/m0/s1 |
| InChIKey | MKRGIMKIQBCAGE-AZTWYYBJSA-N |
| XLogP | 1.97 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|