About 4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide
4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide (PubChem CID 129160899) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide |
| PubChem CID | 129160899 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide |
| SMILES | NC(=O)c1n[nH]c2c1CC=NC2 |
| InChI | InChI=1S/C7H8N4O/c8-7(12)6-4-1-2-9-3-5(4)10-11-6/h2H,1,3H2,(H2,8,12)(H,10,11) |
| InChIKey | ZUXAXNSDRVDNLZ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide?
The IUPAC name of 4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide (CID 129160899) is 4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide.
What is the SMILES notation for 4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide?
The canonical SMILES for 4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide is NC(=O)c1n[nH]c2c1CC=NC2.
What is the InChIKey of 4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide?
The InChIKey is ZUXAXNSDRVDNLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c8-7(12)6-4-1-2-9-3-5(4)10-11-6/h2H,1,3H2,(H2,8,12)(H,10,11).
What are the key properties of 4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide?
4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide has a molecular weight of 164.17 g/mol, XLogP of -0.36, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dihydro-1H-pyrazolo[5,4-c]pyridine-3-carboxamide is sourced from PubChem (CID 129160899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).