C26H33NO5 — CID 129161064
7-(3,4-dimethoxyphenyl)-8-(2,3,4-trimethoxyphenyl)-2,3,4,6,9,9a-hexahydro-1H-quinolizine (PubChem CID 129161064) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-8-(2,3,4-trimethoxyphenyl)-2,3,4,6,9,9a-hexahydro-1H-quinolizine.
| Compound Name | 7-(3,4-dimethoxyphenyl)-8-(2,3,4-trimethoxyphenyl)-2,3,4,6,9,9a-hexahydro-1H-quinolizine |
|---|---|
| PubChem CID | 129161064 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-8-(2,3,4-trimethoxyphenyl)-2,3,4,6,9,9a-hexahydro-1H-quinolizine |
| SMILES | COc1ccc(C2=C(c3ccc(OC)c(OC)c3OC)CC3CCCCN3C2)cc1OC |
| InChI | InChI=1S/C26H33NO5/c1-28-22-11-9-17(14-24(22)30-3)21-16-27-13-7-6-8-18(27)15-20(21)19-10-12-23(29-2)26(32-5)25(19)31-4/h9-12,14,18H,6-8,13,15-16H2,1-5H3 |
| InChIKey | ZYDLLFLPKVFUSG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|