C32H57N — CID 129161140
(6Z,13R,15R,17Z,19Z)-15-ethyl-2,6,13,14,21-pentamethyl-7-prop-1-en-2-yldocosa-6,17,19-trien-10-imine (PubChem CID 129161140) has the molecular formula C32H57N and a molecular weight of 455.82 g/mol. Its IUPAC name is (6Z,13R,15R,17Z,19Z)-15-ethyl-2,6,13,14,21-pentamethyl-7-prop-1-en-2-yldocosa-6,17,19-trien-10-imine.
| Compound Name | (6Z,13R,15R,17Z,19Z)-15-ethyl-2,6,13,14,21-pentamethyl-7-prop-1-en-2-yldocosa-6,17,19-trien-10-imine |
|---|---|
| PubChem CID | 129161140 |
| Molecular Formula | C32H57N |
| Molecular Weight | 455.82 g/mol |
| Exact Mass | 455.45 |
| IUPAC Name | (6Z,13R,15R,17Z,19Z)-15-ethyl-2,6,13,14,21-pentamethyl-7-prop-1-en-2-yldocosa-6,17,19-trien-10-imine |
| SMILES | [H]/N=C(/CC/C(C(=C)C)=C(\C)CCCC(C)C)CC[C@@H](C)C(C)[C@H](CC)C/C=C\C=C/C(C)C |
| InChI | InChI=1S/C32H57N/c1-11-30(19-14-12-13-16-24(2)3)29(10)27(8)20-21-31(33)22-23-32(26(6)7)28(9)18-15-17-25(4)5/h12-14,16,24-25,27,29-30,33H,6,11,15,17-23H2,1-5,7-10H3/b14-12-,16-13-,32-28-,33-31+/t27-,29?,30-/m1/s1 |
| InChIKey | MDMNABVMEIXDCE-CODVEMRZSA-N |
| XLogP | 10.74 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.82 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|