About N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide
N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide (PubChem CID 129161143) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide.
Molecular Properties
| Compound Name | N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide |
| PubChem CID | 129161143 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide |
| SMILES | [H]/N=C(\N=N\N)C1C=CC(C)=C(C)C1 |
| InChI | InChI=1S/C9H14N4/c1-6-3-4-8(5-7(6)2)9(10)12-13-11/h3-4,8H,5H2,1-2H3,(H3,10,11,12) |
| InChIKey | PMNLPMVYJAGJRA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide?
The IUPAC name of N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide (CID 129161143) is N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide.
What is the SMILES notation for N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide?
The canonical SMILES for N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide is [H]/N=C(\N=N\N)C1C=CC(C)=C(C)C1.
What is the InChIKey of N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide?
The InChIKey is PMNLPMVYJAGJRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4/c1-6-3-4-8(5-7(6)2)9(10)12-13-11/h3-4,8H,5H2,1-2H3,(H3,10,11,12).
What are the key properties of N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide?
N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide has a molecular weight of 178.24 g/mol, XLogP of 2.20, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydrazinylidene-4,5-dimethylcyclohexa-2,4-diene-1-carboximidamide is sourced from PubChem (CID 129161143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).