About (5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene
(5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene (PubChem CID 129161146) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is (5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | (5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene |
| PubChem CID | 129161146 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | (5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene |
| SMILES | CC1=C[C@H](CCN=[N+]=[N-])C=C1 |
| InChI | InChI=1S/C8H11N3/c1-7-2-3-8(6-7)4-5-10-11-9/h2-3,6,8H,4-5H2,1H3/t8-/m0/s1 |
| InChIKey | ATZXPKKWDCICST-QMMMGPOBSA-N |
| XLogP | 2.82 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene?
The IUPAC name of (5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene (CID 129161146) is (5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene.
What is the SMILES notation for (5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene?
The canonical SMILES for (5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene is CC1=C[C@H](CCN=[N+]=[N-])C=C1.
What is the InChIKey of (5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene?
The InChIKey is ATZXPKKWDCICST-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H11N3/c1-7-2-3-8(6-7)4-5-10-11-9/h2-3,6,8H,4-5H2,1H3/t8-/m0/s1.
What are the key properties of (5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene?
(5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene has a molecular weight of 149.20 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(2-azidoethyl)-2-methylcyclopenta-1,3-diene is sourced from PubChem (CID 129161146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).