C17H20N2 — CID 129161226
(2Z,5Z)-N-[3-(ethylideneamino)buta-1,3-dien-2-yl]-4,7-dimethylidenenona-2,5,8-trien-1-imine (PubChem CID 129161226) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (2Z,5Z)-N-[3-(ethylideneamino)buta-1,3-dien-2-yl]-4,7-dimethylidenenona-2,5,8-trien-1-imine.
| Compound Name | (2Z,5Z)-N-[3-(ethylideneamino)buta-1,3-dien-2-yl]-4,7-dimethylidenenona-2,5,8-trien-1-imine |
|---|---|
| PubChem CID | 129161226 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (2Z,5Z)-N-[3-(ethylideneamino)buta-1,3-dien-2-yl]-4,7-dimethylidenenona-2,5,8-trien-1-imine |
| SMILES | C=CC(=C)/C=C\C(=C)/C=C\C=N\C(=C)C(=C)/N=C/C |
| InChI | InChI=1S/C17H20N2/c1-7-14(3)11-12-15(4)10-9-13-19-17(6)16(5)18-8-2/h7-13H,1,3-6H2,2H3/b10-9-,12-11-,18-8+,19-13+ |
| InChIKey | KOFHHHYYWZUNDU-CDKDYUDKSA-N |
| XLogP | 4.59 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|