C28H31NO14 — CID 129161748
2-[4-[[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-(2-hydroxypropanoyloxy)-4-oxobutanoyl]oxybutanedioic acid (PubChem CID 129161748) has the molecular formula C28H31NO14 and a molecular weight of 605.55 g/mol. Its IUPAC name is 2-[4-[[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-(2-hydroxypropanoyloxy)-4-oxobutanoyl]oxybutanedioic acid.
| Compound Name | 2-[4-[[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-(2-hydroxypropanoyloxy)-4-oxobutanoyl]oxybutanedioic acid |
|---|---|
| PubChem CID | 129161748 |
| Molecular Formula | C28H31NO14 |
| Molecular Weight | 605.55 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | 2-[4-[[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-(2-hydroxypropanoyloxy)-4-oxobutanoyl]oxybutanedioic acid |
| SMILES | CC(O)C(=O)OC(CC(=O)OC1=CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3C)[C@H]1O5)C(=O)OC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C28H31NO14/c1-12(30)25(37)42-17(26(38)41-16(24(35)36)10-19(32)33)11-20(34)40-15-5-6-28(39)18-9-13-3-4-14(31)22-21(13)27(28,23(15)43-22)7-8-29(18)2/h3-5,12,16-18,23,30-31,39H,6-11H2,1-2H3,(H,32,33)(H,35,36)/t12?,16?,17?,18-,23+,27+,28-/m1/s1 |
| InChIKey | TZLKQICQTCJXDX-OMFVKOJASA-N |
| XLogP | -0.63 |
| TPSA | 226.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.55 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|