C30H34ClN3O6 — CID 129162138
1-acetyloxyethyl 4-[[(2R)-3-(5-chlorocyclohepta-2,4-dien-6-yn-1-yl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoate (PubChem CID 129162138) has the molecular formula C30H34ClN3O6 and a molecular weight of 568.07 g/mol. Its IUPAC name is 1-acetyloxyethyl 4-[[(2R)-3-(5-chlorocyclohepta-2,4-dien-6-yn-1-yl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoate.
| Compound Name | 1-acetyloxyethyl 4-[[(2R)-3-(5-chlorocyclohepta-2,4-dien-6-yn-1-yl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoate |
|---|---|
| PubChem CID | 129162138 |
| Molecular Formula | C30H34ClN3O6 |
| Molecular Weight | 568.07 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 1-acetyloxyethyl 4-[[(2R)-3-(5-chlorocyclohepta-2,4-dien-6-yn-1-yl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OC(C)OC(C)=O)ccc1NC(=O)[C@@H]1NC(CC(C)(C)C)C(C#N)C1C1C#CC(Cl)=CC=C1 |
| InChI | InChI=1S/C30H34ClN3O6/c1-17(35)39-18(2)40-29(37)20-11-13-23(25(14-20)38-6)34-28(36)27-26(19-8-7-9-21(31)12-10-19)22(16-32)24(33-27)15-30(3,4)5/h7-9,11,13-14,18-19,22,24,26-27,33H,15H2,1-6H3,(H,34,36)/t18?,19?,22?,24?,26?,27-/m1/s1 |
| InChIKey | FLYWFGCVRAUCHA-ZVVYFVLQSA-N |
| XLogP | 4.54 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.07 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|