C19H10F12N2 — CID 129162492
4,6,12,14-tetrakis(trifluoromethyl)-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene (PubChem CID 129162492) has the molecular formula C19H10F12N2 and a molecular weight of 494.28 g/mol. Its IUPAC name is 4,6,12,14-tetrakis(trifluoromethyl)-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene.
| Compound Name | 4,6,12,14-tetrakis(trifluoromethyl)-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene |
|---|---|
| PubChem CID | 129162492 |
| Molecular Formula | C19H10F12N2 |
| Molecular Weight | 494.28 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 4,6,12,14-tetrakis(trifluoromethyl)-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene |
| SMILES | FC(F)(F)c1cc2c(c(C(F)(F)F)c1)CN1CN2Cc2c1cc(C(F)(F)F)cc2C(F)(F)F |
| InChI | InChI=1S/C19H10F12N2/c20-16(21,22)8-1-12(18(26,27)28)10-5-32-7-33(14(10)3-8)6-11-13(19(29,30)31)2-9(4-15(11)32)17(23,24)25/h1-4H,5-7H2 |
| InChIKey | GONUBYWGNCKQSW-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.28 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |