C15H20N2 — CID 129162549
(4aE)-1-[(3E)-penta-1,3-dien-3-yl]-6,7,8,9,10,10a-hexahydrocycloocta[d]pyridazine (PubChem CID 129162549) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (4aE)-1-[(3E)-penta-1,3-dien-3-yl]-6,7,8,9,10,10a-hexahydrocycloocta[d]pyridazine.
| Compound Name | (4aE)-1-[(3E)-penta-1,3-dien-3-yl]-6,7,8,9,10,10a-hexahydrocycloocta[d]pyridazine |
|---|---|
| PubChem CID | 129162549 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (4aE)-1-[(3E)-penta-1,3-dien-3-yl]-6,7,8,9,10,10a-hexahydrocycloocta[d]pyridazine |
| SMILES | C=C/C(=C\C)C1=NN=C/C2=C/CCCCCC12 |
| InChI | InChI=1S/C15H20N2/c1-3-12(4-2)15-14-10-8-6-5-7-9-13(14)11-16-17-15/h3-4,9,11,14H,1,5-8,10H2,2H3/b12-4+,13-9- |
| InChIKey | VFBGNZLECGMNGC-CQANSVCRSA-N |
| XLogP | 4.07 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|