C13H22O2 — CID 129162581
(1,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl) acetate (PubChem CID 129162581) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (1,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl) acetate.
| Compound Name | (1,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl) acetate |
|---|---|
| PubChem CID | 129162581 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (1,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C(C)CCC2C1 |
| InChI | InChI=1S/C13H22O2/c1-9-4-5-11-8-12(15-10(2)14)6-7-13(9,11)3/h9,11-12H,4-8H2,1-3H3 |
| InChIKey | PSPAHDJGNVLGDJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |