About 3,6-di(piperazin-1-yl)-1,2,4-triazine
3,6-di(piperazin-1-yl)-1,2,4-triazine (PubChem CID 129162608) has the molecular formula C11H19N7
and a molecular weight of 249.32 g/mol. Its IUPAC name is 3,6-di(piperazin-1-yl)-1,2,4-triazine.
Molecular Properties
| Compound Name | 3,6-di(piperazin-1-yl)-1,2,4-triazine |
| PubChem CID | 129162608 |
| Molecular Formula | C11H19N7 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 3,6-di(piperazin-1-yl)-1,2,4-triazine |
| SMILES | c1nc(N2CCNCC2)nnc1N1CCNCC1 |
| InChI | InChI=1S/C11H19N7/c1-5-17(6-2-12-1)10-9-14-11(16-15-10)18-7-3-13-4-8-18/h9,12-13H,1-8H2 |
| InChIKey | GNBIJQHZRSYOLK-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3,6-di(piperazin-1-yl)-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-di(piperazin-1-yl)-1,2,4-triazine?
The IUPAC name of 3,6-di(piperazin-1-yl)-1,2,4-triazine (CID 129162608) is 3,6-di(piperazin-1-yl)-1,2,4-triazine.
What is the SMILES notation for 3,6-di(piperazin-1-yl)-1,2,4-triazine?
The canonical SMILES for 3,6-di(piperazin-1-yl)-1,2,4-triazine is c1nc(N2CCNCC2)nnc1N1CCNCC1.
What is the InChIKey of 3,6-di(piperazin-1-yl)-1,2,4-triazine?
The InChIKey is GNBIJQHZRSYOLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N7/c1-5-17(6-2-12-1)10-9-14-11(16-15-10)18-7-3-13-4-8-18/h9,12-13H,1-8H2.
What are the key properties of 3,6-di(piperazin-1-yl)-1,2,4-triazine?
3,6-di(piperazin-1-yl)-1,2,4-triazine has a molecular weight of 249.32 g/mol, XLogP of -1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-di(piperazin-1-yl)-1,2,4-triazine is sourced from PubChem (CID 129162608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).