C10H18N4O — CID 129162779
4,6-dimethyl-7-(2H-tetrazol-5-yl)heptan-2-one (PubChem CID 129162779) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 4,6-dimethyl-7-(2H-tetrazol-5-yl)heptan-2-one.
| Compound Name | 4,6-dimethyl-7-(2H-tetrazol-5-yl)heptan-2-one |
|---|---|
| PubChem CID | 129162779 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 4,6-dimethyl-7-(2H-tetrazol-5-yl)heptan-2-one |
| SMILES | CC(=O)CC(C)CC(C)Cc1nn[nH]n1 |
| InChI | InChI=1S/C10H18N4O/c1-7(5-9(3)15)4-8(2)6-10-11-13-14-12-10/h7-8H,4-6H2,1-3H3,(H,11,12,13,14) |
| InChIKey | AGYBKDJWTYQKFC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |