C22H23N5O — CID 129163955
(2S,3E,5Z)-3-ethenyl-1-(5-phenyl-2-pyridinyl)-2-(tetrazol-1-ylmethyl)hepta-3,5-dien-2-ol (PubChem CID 129163955) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is (2S,3E,5Z)-3-ethenyl-1-(5-phenyl-2-pyridinyl)-2-(tetrazol-1-ylmethyl)hepta-3,5-dien-2-ol.
| Compound Name | (2S,3E,5Z)-3-ethenyl-1-(5-phenyl-2-pyridinyl)-2-(tetrazol-1-ylmethyl)hepta-3,5-dien-2-ol |
|---|---|
| PubChem CID | 129163955 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (2S,3E,5Z)-3-ethenyl-1-(5-phenyl-2-pyridinyl)-2-(tetrazol-1-ylmethyl)hepta-3,5-dien-2-ol |
| SMILES | C=C/C(=C\C=C/C)[C@@](O)(Cc1ccc(-c2ccccc2)cn1)Cn1cnnn1 |
| InChI | InChI=1S/C22H23N5O/c1-3-5-11-20(4-2)22(28,16-27-17-24-25-26-27)14-21-13-12-19(15-23-21)18-9-7-6-8-10-18/h3-13,15,17,28H,2,14,16H2,1H3/b5-3-,20-11+/t22-/m1/s1 |
| InChIKey | MDCOLCJBXWBYNM-ZTYWAVBNSA-N |
| XLogP | 3.40 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|