About 2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride
2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride (PubChem CID 129164538) has the molecular formula C30H26ClNO3S
and a molecular weight of 516.06 g/mol. Its IUPAC name is 2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride.
Molecular Properties
| Compound Name | 2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride |
| PubChem CID | 129164538 |
| Molecular Formula | C30H26ClNO3S |
| Molecular Weight | 516.06 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride |
| SMILES | C=c1ccc2c(c1)Oc1cc(Nc3c(CC)cccc3CC)ccc1C=2c1ccccc1S(=O)(=O)Cl |
| InChI | InChI=1S/C30H26ClNO3S/c1-4-20-9-8-10-21(5-2)30(20)32-22-14-16-24-27(18-22)35-26-17-19(3)13-15-23(26)29(24)25-11-6-7-12-28(25)36(31,33)34/h6-18,32H,3-5H2,1-2H3 |
| InChIKey | DHOJJEMQOPFVBT-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.06 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride?
The IUPAC name of 2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride (CID 129164538) is 2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride.
What is the SMILES notation for 2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride?
The canonical SMILES for 2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride is C=c1ccc2c(c1)Oc1cc(Nc3c(CC)cccc3CC)ccc1C=2c1ccccc1S(=O)(=O)Cl.
What is the InChIKey of 2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride?
The InChIKey is DHOJJEMQOPFVBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H26ClNO3S/c1-4-20-9-8-10-21(5-2)30(20)32-22-14-16-24-27(18-22)35-26-17-19(3)13-15-23(26)29(24)25-11-6-7-12-28(25)36(31,33)34/h6-18,32H,3-5H2,1-2H3.
What are the key properties of 2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride?
2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride has a molecular weight of 516.06 g/mol, XLogP of 6.25, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,6-diethylanilino)-6-methylidenexanthen-9-yl]benzenesulfonyl chloride is sourced from PubChem (CID 129164538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).