About S-(3-methylphenyl) N,N-diethylcarbamothioate
S-(3-methylphenyl) N,N-diethylcarbamothioate (PubChem CID 12916476) has the molecular formula C12H17NOS
and a molecular weight of 223.34 g/mol. Its IUPAC name is S-(3-methylphenyl) N,N-diethylcarbamothioate.
Molecular Properties
| Compound Name | S-(3-methylphenyl) N,N-diethylcarbamothioate |
| PubChem CID | 12916476 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | S-(3-methylphenyl) N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=O)Sc1cccc(C)c1 |
| InChI | InChI=1S/C12H17NOS/c1-4-13(5-2)12(14)15-11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3 |
| InChIKey | ULMWWVULHUHLLN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-methylphenyl) N,N-diethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-methylphenyl) N,N-diethylcarbamothioate?
The IUPAC name of S-(3-methylphenyl) N,N-diethylcarbamothioate (CID 12916476) is S-(3-methylphenyl) N,N-diethylcarbamothioate.
What is the SMILES notation for S-(3-methylphenyl) N,N-diethylcarbamothioate?
The canonical SMILES for S-(3-methylphenyl) N,N-diethylcarbamothioate is CCN(CC)C(=O)Sc1cccc(C)c1.
What is the InChIKey of S-(3-methylphenyl) N,N-diethylcarbamothioate?
The InChIKey is ULMWWVULHUHLLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NOS/c1-4-13(5-2)12(14)15-11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3.
What are the key properties of S-(3-methylphenyl) N,N-diethylcarbamothioate?
S-(3-methylphenyl) N,N-diethylcarbamothioate has a molecular weight of 223.34 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-methylphenyl) N,N-diethylcarbamothioate is sourced from PubChem (CID 12916476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).