C22H15BrClNO2 — CID 129165081
9-(4-bromophenyl)-5-chloro-10-phenyl-8,13-dioxa-3-azatetracyclo[7.4.0.01,12.02,7]trideca-2(7),3,5-triene (PubChem CID 129165081) has the molecular formula C22H15BrClNO2 and a molecular weight of 440.72 g/mol. Its IUPAC name is 9-(4-bromophenyl)-5-chloro-10-phenyl-8,13-dioxa-3-azatetracyclo[7.4.0.01,12.02,7]trideca-2(7),3,5-triene.
| Compound Name | 9-(4-bromophenyl)-5-chloro-10-phenyl-8,13-dioxa-3-azatetracyclo[7.4.0.01,12.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 129165081 |
| Molecular Formula | C22H15BrClNO2 |
| Molecular Weight | 440.72 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | 9-(4-bromophenyl)-5-chloro-10-phenyl-8,13-dioxa-3-azatetracyclo[7.4.0.01,12.02,7]trideca-2(7),3,5-triene |
| SMILES | Clc1cnc2c(c1)OC1(c3ccc(Br)cc3)C(c3ccccc3)CC3OC231 |
| InChI | InChI=1S/C22H15BrClNO2/c23-15-8-6-14(7-9-15)21-17(13-4-2-1-3-5-13)11-19-22(21,27-19)20-18(26-21)10-16(24)12-25-20/h1-10,12,17,19H,11H2 |
| InChIKey | YWHMKCWLVJNDCK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 34.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.72 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|