C16H15ClF2N2O2 — CID 129165325
2-[1-(3-chloro-2,6-difluorophenyl)ethyl]-7-hydroxy-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one (PubChem CID 129165325) has the molecular formula C16H15ClF2N2O2 and a molecular weight of 340.76 g/mol. Its IUPAC name is 2-[1-(3-chloro-2,6-difluorophenyl)ethyl]-7-hydroxy-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one.
| Compound Name | 2-[1-(3-chloro-2,6-difluorophenyl)ethyl]-7-hydroxy-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one |
|---|---|
| PubChem CID | 129165325 |
| Molecular Formula | C16H15ClF2N2O2 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-[1-(3-chloro-2,6-difluorophenyl)ethyl]-7-hydroxy-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one |
| SMILES | CC(c1c(F)ccc(Cl)c1F)N1CCn2cc(O)c(=O)cc2C1 |
| InChI | InChI=1S/C16H15ClF2N2O2/c1-9(15-12(18)3-2-11(17)16(15)19)20-4-5-21-8-14(23)13(22)6-10(21)7-20/h2-3,6,8-9,23H,4-5,7H2,1H3 |
| InChIKey | PKGLQYSWBDHQEE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|