About 2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile
2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile (PubChem CID 129165527) has the molecular formula C16H15N3O2
and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile |
| PubChem CID | 129165527 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1CCn2cc(O)c(=O)cc2C1 |
| InChI | InChI=1S/C16H15N3O2/c17-8-12-3-1-2-4-13(12)9-18-5-6-19-11-16(21)15(20)7-14(19)10-18/h1-4,7,11,21H,5-6,9-10H2 |
| InChIKey | VTAHZIGIHABBAU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile?
The IUPAC name of 2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile (CID 129165527) is 2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile.
What is the SMILES notation for 2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile?
The canonical SMILES for 2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile is N#Cc1ccccc1CN1CCn2cc(O)c(=O)cc2C1.
What is the InChIKey of 2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile?
The InChIKey is VTAHZIGIHABBAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O2/c17-8-12-3-1-2-4-13(12)9-18-5-6-19-11-16(21)15(20)7-14(19)10-18/h1-4,7,11,21H,5-6,9-10H2.
What are the key properties of 2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile?
2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile has a molecular weight of 281.31 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-hydroxy-8-oxo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-2-yl)methyl]benzonitrile is sourced from PubChem (CID 129165527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).