C25H28FN3O — CID 129166337
1-[4-(4-fluorophenyl)-7-[(3-propan-2-ylpiperazin-1-yl)methyl]quinolin-2-yl]ethanone (PubChem CID 129166337) has the molecular formula C25H28FN3O and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)-7-[(3-propan-2-ylpiperazin-1-yl)methyl]quinolin-2-yl]ethanone.
| Compound Name | 1-[4-(4-fluorophenyl)-7-[(3-propan-2-ylpiperazin-1-yl)methyl]quinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 129166337 |
| Molecular Formula | C25H28FN3O |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1-[4-(4-fluorophenyl)-7-[(3-propan-2-ylpiperazin-1-yl)methyl]quinolin-2-yl]ethanone |
| SMILES | CC(=O)c1cc(-c2ccc(F)cc2)c2ccc(CN3CCNC(C(C)C)C3)cc2n1 |
| InChI | InChI=1S/C25H28FN3O/c1-16(2)25-15-29(11-10-27-25)14-18-4-9-21-22(19-5-7-20(26)8-6-19)13-23(17(3)30)28-24(21)12-18/h4-9,12-13,16,25,27H,10-11,14-15H2,1-3H3 |
| InChIKey | SJTOOQKMSPCKJC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |