About 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline
4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline (PubChem CID 129166439) has the molecular formula C12H8N4O3S
and a molecular weight of 288.29 g/mol. Its IUPAC name is 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline.
Molecular Properties
| Compound Name | 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline |
| PubChem CID | 129166439 |
| Molecular Formula | C12H8N4O3S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline |
| SMILES | Nc1ccc(Sc2ccc([N+](=O)[O-])c3nonc23)cc1 |
| InChI | InChI=1S/C12H8N4O3S/c13-7-1-3-8(4-2-7)20-10-6-5-9(16(17)18)11-12(10)15-19-14-11/h1-6H,13H2 |
| InChIKey | VHTKHHOZJRJJHN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline?
The IUPAC name of 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline (CID 129166439) is 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline.
What is the SMILES notation for 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline?
The canonical SMILES for 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline is Nc1ccc(Sc2ccc([N+](=O)[O-])c3nonc23)cc1.
What is the InChIKey of 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline?
The InChIKey is VHTKHHOZJRJJHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O3S/c13-7-1-3-8(4-2-7)20-10-6-5-9(16(17)18)11-12(10)15-19-14-11/h1-6H,13H2.
What are the key properties of 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline?
4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline has a molecular weight of 288.29 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]aniline is sourced from PubChem (CID 129166439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).