C7H4N6O2 — CID 129166447
4-azido-6,7-dihydropyrido[2,3-d]pyridazine-5,8-dione (PubChem CID 129166447) has the molecular formula C7H4N6O2 and a molecular weight of 204.15 g/mol. Its IUPAC name is 4-azido-6,7-dihydropyrido[2,3-d]pyridazine-5,8-dione.
| Compound Name | 4-azido-6,7-dihydropyrido[2,3-d]pyridazine-5,8-dione |
|---|---|
| PubChem CID | 129166447 |
| Molecular Formula | C7H4N6O2 |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 4-azido-6,7-dihydropyrido[2,3-d]pyridazine-5,8-dione |
| SMILES | [N-]=[N+]=Nc1ccnc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C7H4N6O2/c8-13-10-3-1-2-9-5-4(3)6(14)11-12-7(5)15/h1-2H,(H,11,14)(H,12,15) |
| InChIKey | WWKPVVRMWIVEGS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|