About 4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide
4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide (PubChem CID 129166573) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is 4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide.
Molecular Properties
| Compound Name | 4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide |
| PubChem CID | 129166573 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide |
| SMILES | COCC1=CC=C(C(=O)N=O)CC1 |
| InChI | InChI=1S/C9H11NO3/c1-13-6-7-2-4-8(5-3-7)9(11)10-12/h2,4H,3,5-6H2,1H3 |
| InChIKey | FXYDNBGHPBMGSY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide?
The IUPAC name of 4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide (CID 129166573) is 4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide.
What is the SMILES notation for 4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide?
The canonical SMILES for 4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide is COCC1=CC=C(C(=O)N=O)CC1.
What is the InChIKey of 4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide?
The InChIKey is FXYDNBGHPBMGSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-13-6-7-2-4-8(5-3-7)9(11)10-12/h2,4H,3,5-6H2,1H3.
What are the key properties of 4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide?
4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide has a molecular weight of 181.19 g/mol, XLogP of 1.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxymethyl)-N-oxocyclohexa-1,3-diene-1-carboxamide is sourced from PubChem (CID 129166573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).