About 4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine
4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine (PubChem CID 129166592) has the molecular formula C11H17ClFN
and a molecular weight of 217.72 g/mol. Its IUPAC name is 4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine.
Molecular Properties
| Compound Name | 4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine |
| PubChem CID | 129166592 |
| Molecular Formula | C11H17ClFN |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine |
| SMILES | C/C=C(\C=C/CCl)C1(F)CCNCC1 |
| InChI | InChI=1S/C11H17ClFN/c1-2-10(4-3-7-12)11(13)5-8-14-9-6-11/h2-4,14H,5-9H2,1H3/b4-3-,10-2+ |
| InChIKey | UJAMUGCJJXHIKF-MXSDMKSISA-N |
| XLogP | 2.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine?
The IUPAC name of 4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine (CID 129166592) is 4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine.
What is the SMILES notation for 4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine?
The canonical SMILES for 4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine is C/C=C(\C=C/CCl)C1(F)CCNCC1.
What is the InChIKey of 4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine?
The InChIKey is UJAMUGCJJXHIKF-MXSDMKSISA-N. The full InChI is InChI=1S/C11H17ClFN/c1-2-10(4-3-7-12)11(13)5-8-14-9-6-11/h2-4,14H,5-9H2,1H3/b4-3-,10-2+.
What are the key properties of 4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine?
4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine has a molecular weight of 217.72 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-4-fluoropiperidine is sourced from PubChem (CID 129166592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).